C19H22BrNO2S — CID 129038444
O-methyl N-[3-bromo-2-[(2-ethyl-4,5-dimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129038444) has the molecular formula C19H22BrNO2S and a molecular weight of 408.36 g/mol. Its IUPAC name is O-methyl N-[3-bromo-2-[(2-ethyl-4,5-dimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | O-methyl N-[3-bromo-2-[(2-ethyl-4,5-dimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129038444 |
| Molecular Formula | C19H22BrNO2S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | O-methyl N-[3-bromo-2-[(2-ethyl-4,5-dimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CCc1cc(C)c(C)cc1OCc1c(Br)cccc1NC(=S)OC |
| InChI | InChI=1S/C19H22BrNO2S/c1-5-14-9-12(2)13(3)10-18(14)23-11-15-16(20)7-6-8-17(15)21-19(24)22-4/h6-10H,5,11H2,1-4H3,(H,21,24) |
| InChIKey | NJKYTSCJCOTPGX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|