C21H27NO2S — CID 126588081
O-methyl N-[2-[(2,4-diethylphenoxy)methyl]-3-ethylphenyl]carbamothioate (PubChem CID 126588081) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is O-methyl N-[2-[(2,4-diethylphenoxy)methyl]-3-ethylphenyl]carbamothioate.
| Compound Name | O-methyl N-[2-[(2,4-diethylphenoxy)methyl]-3-ethylphenyl]carbamothioate |
|---|---|
| PubChem CID | 126588081 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | O-methyl N-[2-[(2,4-diethylphenoxy)methyl]-3-ethylphenyl]carbamothioate |
| SMILES | CCc1ccc(OCc2c(CC)cccc2NC(=S)OC)c(CC)c1 |
| InChI | InChI=1S/C21H27NO2S/c1-5-15-11-12-20(17(7-3)13-15)24-14-18-16(6-2)9-8-10-19(18)22-21(25)23-4/h8-13H,5-7,14H2,1-4H3,(H,22,25) |
| InChIKey | HDKPKFGYGFSZPL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|