C20H24BrNO2S — CID 126588679
O-methyl N-[2-[(2-bromo-4-ethyl-5-methylphenoxy)methyl]-3-ethylphenyl]carbamothioate (PubChem CID 126588679) has the molecular formula C20H24BrNO2S and a molecular weight of 422.39 g/mol. Its IUPAC name is O-methyl N-[2-[(2-bromo-4-ethyl-5-methylphenoxy)methyl]-3-ethylphenyl]carbamothioate.
| Compound Name | O-methyl N-[2-[(2-bromo-4-ethyl-5-methylphenoxy)methyl]-3-ethylphenyl]carbamothioate |
|---|---|
| PubChem CID | 126588679 |
| Molecular Formula | C20H24BrNO2S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | O-methyl N-[2-[(2-bromo-4-ethyl-5-methylphenoxy)methyl]-3-ethylphenyl]carbamothioate |
| SMILES | CCc1cc(Br)c(OCc2c(CC)cccc2NC(=S)OC)cc1C |
| InChI | InChI=1S/C20H24BrNO2S/c1-5-14-8-7-9-18(22-20(25)23-4)16(14)12-24-19-10-13(3)15(6-2)11-17(19)21/h7-11H,5-6,12H2,1-4H3,(H,22,25) |
| InChIKey | JQCXCENOPUVANE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|