C22H29NO2S — CID 126588414
O-ethyl N-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 126588414) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is O-ethyl N-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | O-ethyl N-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 126588414 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | O-ethyl N-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CCOC(=S)Nc1cccc(CC)c1COc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C22H29NO2S/c1-6-17-10-9-11-20(23-22(26)24-8-3)19(17)14-25-21-13-15(4)18(7-2)12-16(21)5/h9-13H,6-8,14H2,1-5H3,(H,23,26) |
| InChIKey | NPLFVPSAJOOTMO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|