C16H15BrINO2S — CID 129038550
O-methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-iodophenyl]carbamothioate (PubChem CID 129038550) has the molecular formula C16H15BrINO2S and a molecular weight of 492.18 g/mol. Its IUPAC name is O-methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-iodophenyl]carbamothioate.
| Compound Name | O-methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-iodophenyl]carbamothioate |
|---|---|
| PubChem CID | 129038550 |
| Molecular Formula | C16H15BrINO2S |
| Molecular Weight | 492.18 g/mol |
| Exact Mass | 490.91 |
| IUPAC Name | O-methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-iodophenyl]carbamothioate |
| SMILES | COC(=S)Nc1cccc(I)c1COc1ccc(C)cc1Br |
| InChI | InChI=1S/C16H15BrINO2S/c1-10-6-7-15(12(17)8-10)21-9-11-13(18)4-3-5-14(11)19-16(22)20-2/h3-8H,9H2,1-2H3,(H,19,22) |
| InChIKey | PZPDVMZYSIBGCS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.18 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|