C16H15BrClNO3 — CID 129038323
methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-chlorophenyl]carbamate (PubChem CID 129038323) has the molecular formula C16H15BrClNO3 and a molecular weight of 384.66 g/mol. Its IUPAC name is methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-chlorophenyl]carbamate.
| Compound Name | methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 129038323 |
| Molecular Formula | C16H15BrClNO3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | methyl N-[2-[(2-bromo-4-methylphenoxy)methyl]-3-chlorophenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(Cl)c1COc1ccc(C)cc1Br |
| InChI | InChI=1S/C16H15BrClNO3/c1-10-6-7-15(12(17)8-10)22-9-11-13(18)4-3-5-14(11)19-16(20)21-2/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | UYAAIIPZCMKUTG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |