C15H15BrClN3O2 — CID 144785007
1-amino-3-[2-[(4-bromo-2-methylphenoxy)methyl]-3-chlorophenyl]urea (PubChem CID 144785007) has the molecular formula C15H15BrClN3O2 and a molecular weight of 384.66 g/mol. Its IUPAC name is 1-amino-3-[2-[(4-bromo-2-methylphenoxy)methyl]-3-chlorophenyl]urea.
| Compound Name | 1-amino-3-[2-[(4-bromo-2-methylphenoxy)methyl]-3-chlorophenyl]urea |
|---|---|
| PubChem CID | 144785007 |
| Molecular Formula | C15H15BrClN3O2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 1-amino-3-[2-[(4-bromo-2-methylphenoxy)methyl]-3-chlorophenyl]urea |
| SMILES | Cc1cc(Br)ccc1OCc1c(Cl)cccc1NC(=O)NN |
| InChI | InChI=1S/C15H15BrClN3O2/c1-9-7-10(16)5-6-14(9)22-8-11-12(17)3-2-4-13(11)19-15(21)20-18/h2-7H,8,18H2,1H3,(H2,19,20,21) |
| InChIKey | JUZGLLOJDIQPFU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|