C24H26N4O2 — CID 144772839
1-amino-3-[3-cyclopropyl-2-[[2-methyl-4-(6-methyl-3-pyridinyl)phenoxy]methyl]phenyl]urea (PubChem CID 144772839) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-amino-3-[3-cyclopropyl-2-[[2-methyl-4-(6-methyl-3-pyridinyl)phenoxy]methyl]phenyl]urea.
| Compound Name | 1-amino-3-[3-cyclopropyl-2-[[2-methyl-4-(6-methyl-3-pyridinyl)phenoxy]methyl]phenyl]urea |
|---|---|
| PubChem CID | 144772839 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-amino-3-[3-cyclopropyl-2-[[2-methyl-4-(6-methyl-3-pyridinyl)phenoxy]methyl]phenyl]urea |
| SMILES | Cc1ccc(-c2ccc(OCc3c(NC(=O)NN)cccc3C3CC3)c(C)c2)cn1 |
| InChI | InChI=1S/C24H26N4O2/c1-15-12-18(19-7-6-16(2)26-13-19)10-11-23(15)30-14-21-20(17-8-9-17)4-3-5-22(21)27-24(29)28-25/h3-7,10-13,17H,8-9,14,25H2,1-2H3,(H2,27,28,29) |
| InChIKey | MTORQDSUJGUMFF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|