C21H22N3O2PS — CID 144799725
1-[3-cyclopropyl-2-[[2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenoxy]methyl]phenyl]-1-phosphorosohydrazine (PubChem CID 144799725) has the molecular formula C21H22N3O2PS and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[3-cyclopropyl-2-[[2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenoxy]methyl]phenyl]-1-phosphorosohydrazine.
| Compound Name | 1-[3-cyclopropyl-2-[[2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenoxy]methyl]phenyl]-1-phosphorosohydrazine |
|---|---|
| PubChem CID | 144799725 |
| Molecular Formula | C21H22N3O2PS |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[3-cyclopropyl-2-[[2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenoxy]methyl]phenyl]-1-phosphorosohydrazine |
| SMILES | Cc1csc(-c2ccc(OCc3c(C4CC4)cccc3N(N)P=O)c(C)c2)n1 |
| InChI | InChI=1S/C21H22N3O2PS/c1-13-10-16(21-23-14(2)12-28-21)8-9-20(13)26-11-18-17(15-6-7-15)4-3-5-19(18)24(22)27-25/h3-5,8-10,12,15H,6-7,11,22H2,1-2H3 |
| InChIKey | DGPLSYYHZXPAOA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|