C21H20FN2O3P — CID 144784943
1-[2-[[4-(4-fluorophenyl)-2-methylphenoxy]methyl]-3-methoxyphenyl]-1-phosphorosohydrazine (PubChem CID 144784943) has the molecular formula C21H20FN2O3P and a molecular weight of 398.37 g/mol. Its IUPAC name is 1-[2-[[4-(4-fluorophenyl)-2-methylphenoxy]methyl]-3-methoxyphenyl]-1-phosphorosohydrazine.
| Compound Name | 1-[2-[[4-(4-fluorophenyl)-2-methylphenoxy]methyl]-3-methoxyphenyl]-1-phosphorosohydrazine |
|---|---|
| PubChem CID | 144784943 |
| Molecular Formula | C21H20FN2O3P |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[2-[[4-(4-fluorophenyl)-2-methylphenoxy]methyl]-3-methoxyphenyl]-1-phosphorosohydrazine |
| SMILES | COc1cccc(N(N)P=O)c1COc1ccc(-c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C21H20FN2O3P/c1-14-12-16(15-6-9-17(22)10-7-15)8-11-20(14)27-13-18-19(24(23)28-25)4-3-5-21(18)26-2/h3-12H,13,23H2,1-2H3 |
| InChIKey | ZBCHGHSFTFRMMH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|