C20H28N4O3 — CID 144784769
formohydrazide;1-[3-methoxy-2-[(2-methyl-4-prop-1-en-2-ylphenoxy)methyl]phenyl]-1-methylhydrazine (PubChem CID 144784769) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is formohydrazide;1-[3-methoxy-2-[(2-methyl-4-prop-1-en-2-ylphenoxy)methyl]phenyl]-1-methylhydrazine.
| Compound Name | formohydrazide;1-[3-methoxy-2-[(2-methyl-4-prop-1-en-2-ylphenoxy)methyl]phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144784769 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | formohydrazide;1-[3-methoxy-2-[(2-methyl-4-prop-1-en-2-ylphenoxy)methyl]phenyl]-1-methylhydrazine |
| SMILES | C=C(C)c1ccc(OCc2c(OC)cccc2N(C)N)c(C)c1.NNC=O |
| InChI | InChI=1S/C19H24N2O2.CH4N2O/c1-13(2)15-9-10-18(14(3)11-15)23-12-16-17(21(4)20)7-6-8-19(16)22-5;2-3-1-4/h6-11H,1,12,20H2,2-5H3;1H,2H2,(H,3,4) |
| InChIKey | JDILTTGVVDZRKW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|