C24H32N4O6 — CID 144820644
ethyl 4-[4-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate;formohydrazide (PubChem CID 144820644) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is ethyl 4-[4-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate;formohydrazide.
| Compound Name | ethyl 4-[4-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate;formohydrazide |
|---|---|
| PubChem CID | 144820644 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | ethyl 4-[4-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate;formohydrazide |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)c1ccc(OCc2c(C)cccc2N(C)N)c(C)c1.NNC=O |
| InChI | InChI=1S/C23H28N2O5.CH4N2O/c1-6-29-23(28)22(27)16(4)21(26)17-10-11-20(15(3)12-17)30-13-18-14(2)8-7-9-19(18)25(5)24;2-3-1-4/h7-12,16H,6,13,24H2,1-5H3;1H,2H2,(H,3,4) |
| InChIKey | FUVZQXJCZBVSOK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|