C21H31N7O — CID 144799663
4-[2-[2-[amino(methyl)amino]-6-methylphenyl]ethyl]-3-methyl-N'-(methyliminomethyl)benzenecarboximidamide;formohydrazide (PubChem CID 144799663) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-[2-[2-[amino(methyl)amino]-6-methylphenyl]ethyl]-3-methyl-N'-(methyliminomethyl)benzenecarboximidamide;formohydrazide.
| Compound Name | 4-[2-[2-[amino(methyl)amino]-6-methylphenyl]ethyl]-3-methyl-N'-(methyliminomethyl)benzenecarboximidamide;formohydrazide |
|---|---|
| PubChem CID | 144799663 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 4-[2-[2-[amino(methyl)amino]-6-methylphenyl]ethyl]-3-methyl-N'-(methyliminomethyl)benzenecarboximidamide;formohydrazide |
| SMILES | C/N=C/N=C(\N)c1ccc(CCc2c(C)cccc2N(C)N)c(C)c1.NNC=O |
| InChI | InChI=1S/C20H27N5.CH4N2O/c1-14-6-5-7-19(25(4)22)18(14)11-10-16-8-9-17(12-15(16)2)20(21)24-13-23-3;2-3-1-4/h5-9,12-13H,10-11,22H2,1-4H3,(H2,21,23,24);1H,2H2,(H,3,4) |
| InChIKey | VOZCLNOZXMTVDI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|