C12H22N4O — CID 144780729
N-amino-N-methylformamide;1-(2-ethyl-3-methylphenyl)-1-methylhydrazine (PubChem CID 144780729) has the molecular formula C12H22N4O and a molecular weight of 238.34 g/mol. Its IUPAC name is N-amino-N-methylformamide;1-(2-ethyl-3-methylphenyl)-1-methylhydrazine.
| Compound Name | N-amino-N-methylformamide;1-(2-ethyl-3-methylphenyl)-1-methylhydrazine |
|---|---|
| PubChem CID | 144780729 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-amino-N-methylformamide;1-(2-ethyl-3-methylphenyl)-1-methylhydrazine |
| SMILES | CCc1c(C)cccc1N(C)N.CN(N)C=O |
| InChI | InChI=1S/C10H16N2.C2H6N2O/c1-4-9-8(2)6-5-7-10(9)12(3)11;1-4(3)2-5/h5-7H,4,11H2,1-3H3;2H,3H2,1H3 |
| InChIKey | OKVNMPLDZWMDDZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|