C25H29N5O3 — CID 144815440
N-amino-N-methylformamide;1-methyl-1-[3-methyl-2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]oxymethyl]phenyl]hydrazine (PubChem CID 144815440) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-amino-N-methylformamide;1-methyl-1-[3-methyl-2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]oxymethyl]phenyl]hydrazine.
| Compound Name | N-amino-N-methylformamide;1-methyl-1-[3-methyl-2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]oxymethyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 144815440 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-amino-N-methylformamide;1-methyl-1-[3-methyl-2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]oxymethyl]phenyl]hydrazine |
| SMILES | CN(N)C=O.Cc1ccc(-c2nc3ccc(OCc4c(C)cccc4N(C)N)cc3o2)cc1 |
| InChI | InChI=1S/C23H23N3O2.C2H6N2O/c1-15-7-9-17(10-8-15)23-25-20-12-11-18(13-22(20)28-23)27-14-19-16(2)5-4-6-21(19)26(3)24;1-4(3)2-5/h4-13H,14,24H2,1-3H3;2H,3H2,1H3 |
| InChIKey | JHLPIQYAMURFSY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|