C22H20N2O2 — CID 91678619
4-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenoxy]methyl]aniline (PubChem CID 91678619) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenoxy]methyl]aniline.
| Compound Name | 4-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenoxy]methyl]aniline |
|---|---|
| PubChem CID | 91678619 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenoxy]methyl]aniline |
| SMILES | Cc1cc2nc(-c3ccc(OCc4ccc(N)cc4)cc3)oc2cc1C |
| InChI | InChI=1S/C22H20N2O2/c1-14-11-20-21(12-15(14)2)26-22(24-20)17-5-9-19(10-6-17)25-13-16-3-7-18(23)8-4-16/h3-12H,13,23H2,1-2H3 |
| InChIKey | ZWUDCBDNBAJVEH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|