C23H19NO3 — CID 110494619
(2-phenyl-1,3-benzoxazol-6-yl) 3-(4-methylphenyl)propanoate (PubChem CID 110494619) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2-phenyl-1,3-benzoxazol-6-yl) 3-(4-methylphenyl)propanoate.
| Compound Name | (2-phenyl-1,3-benzoxazol-6-yl) 3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 110494619 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2-phenyl-1,3-benzoxazol-6-yl) 3-(4-methylphenyl)propanoate |
| SMILES | Cc1ccc(CCC(=O)Oc2ccc3nc(-c4ccccc4)oc3c2)cc1 |
| InChI | InChI=1S/C23H19NO3/c1-16-7-9-17(10-8-16)11-14-22(25)26-19-12-13-20-21(15-19)27-23(24-20)18-5-3-2-4-6-18/h2-10,12-13,15H,11,14H2,1H3 |
| InChIKey | SDLVJCBORUZMND-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|