C21H14FNO3 — CID 110494576
(2-phenyl-1,3-benzoxazol-6-yl) 2-(4-fluorophenyl)acetate (PubChem CID 110494576) has the molecular formula C21H14FNO3 and a molecular weight of 347.35 g/mol. Its IUPAC name is (2-phenyl-1,3-benzoxazol-6-yl) 2-(4-fluorophenyl)acetate.
| Compound Name | (2-phenyl-1,3-benzoxazol-6-yl) 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 110494576 |
| Molecular Formula | C21H14FNO3 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (2-phenyl-1,3-benzoxazol-6-yl) 2-(4-fluorophenyl)acetate |
| SMILES | O=C(Cc1ccc(F)cc1)Oc1ccc2nc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C21H14FNO3/c22-16-8-6-14(7-9-16)12-20(24)25-17-10-11-18-19(13-17)26-21(23-18)15-4-2-1-3-5-15/h1-11,13H,12H2 |
| InChIKey | LEVYQAGDTODFEM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|