C15H15BrF2N2O — CID 139453850
1-[2-[(4-bromo-3,5-difluorophenoxy)methyl]-3-methylphenyl]-1-methylhydrazine (PubChem CID 139453850) has the molecular formula C15H15BrF2N2O and a molecular weight of 357.20 g/mol. Its IUPAC name is 1-[2-[(4-bromo-3,5-difluorophenoxy)methyl]-3-methylphenyl]-1-methylhydrazine.
| Compound Name | 1-[2-[(4-bromo-3,5-difluorophenoxy)methyl]-3-methylphenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 139453850 |
| Molecular Formula | C15H15BrF2N2O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-[2-[(4-bromo-3,5-difluorophenoxy)methyl]-3-methylphenyl]-1-methylhydrazine |
| SMILES | Cc1cccc(N(C)N)c1COc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C15H15BrF2N2O/c1-9-4-3-5-14(20(2)19)11(9)8-21-10-6-12(17)15(16)13(18)7-10/h3-7H,8,19H2,1-2H3 |
| InChIKey | USVHAEPJFZULJQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|