C22H32N6OS — CID 144933298
1-[2-[[4-(3,4-dimethyl-1,5-dihydropyrazol-2-yl)-2-methylphenyl]sulfanylmethyl]-3-methylphenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144933298) has the molecular formula C22H32N6OS and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-[2-[[4-(3,4-dimethyl-1,5-dihydropyrazol-2-yl)-2-methylphenyl]sulfanylmethyl]-3-methylphenyl]-1-methylhydrazine;formohydrazide.
| Compound Name | 1-[2-[[4-(3,4-dimethyl-1,5-dihydropyrazol-2-yl)-2-methylphenyl]sulfanylmethyl]-3-methylphenyl]-1-methylhydrazine;formohydrazide |
|---|---|
| PubChem CID | 144933298 |
| Molecular Formula | C22H32N6OS |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[2-[[4-(3,4-dimethyl-1,5-dihydropyrazol-2-yl)-2-methylphenyl]sulfanylmethyl]-3-methylphenyl]-1-methylhydrazine;formohydrazide |
| SMILES | CC1=C(C)N(c2ccc(SCc3c(C)cccc3N(C)N)c(C)c2)NC1.NNC=O |
| InChI | InChI=1S/C21H28N4S.CH4N2O/c1-14-7-6-8-20(24(5)22)19(14)13-26-21-10-9-18(11-15(21)2)25-17(4)16(3)12-23-25;2-3-1-4/h6-11,23H,12-13,22H2,1-5H3;1H,2H2,(H,3,4) |
| InChIKey | VTVWSTNGHSZXRI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|