C22H28N6OS — CID 144933228
1,3-diamino-1-[2-[[4-(3,5-dimethylpyrazol-1-yl)-2,5-dimethylphenyl]sulfanylmethyl]-3-methylphenyl]urea (PubChem CID 144933228) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[4-(3,5-dimethylpyrazol-1-yl)-2,5-dimethylphenyl]sulfanylmethyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[[4-(3,5-dimethylpyrazol-1-yl)-2,5-dimethylphenyl]sulfanylmethyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 144933228 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1,3-diamino-1-[2-[[4-(3,5-dimethylpyrazol-1-yl)-2,5-dimethylphenyl]sulfanylmethyl]-3-methylphenyl]urea |
| SMILES | Cc1cc(C)n(-c2cc(C)c(SCc3c(C)cccc3N(N)C(=O)NN)cc2C)n1 |
| InChI | InChI=1S/C22H28N6OS/c1-13-7-6-8-19(27(24)22(29)25-23)18(13)12-30-21-10-14(2)20(9-15(21)3)28-17(5)11-16(4)26-28/h6-11H,12,23-24H2,1-5H3,(H,25,29) |
| InChIKey | MBKHJGZDGBHXTL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|