C18H19ClN6OS — CID 144932453
1,3-diamino-1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]sulfanylmethyl]-3-methylphenyl]urea (PubChem CID 144932453) has the molecular formula C18H19ClN6OS and a molecular weight of 402.91 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]sulfanylmethyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]sulfanylmethyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 144932453 |
| Molecular Formula | C18H19ClN6OS |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1,3-diamino-1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]sulfanylmethyl]-3-methylphenyl]urea |
| SMILES | Cc1cccc(N(N)C(=O)NN)c1CSc1ccn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H19ClN6OS/c1-12-3-2-4-16(25(21)18(26)22-20)15(12)11-27-17-9-10-24(23-17)14-7-5-13(19)6-8-14/h2-10H,11,20-21H2,1H3,(H,22,26) |
| InChIKey | IKORZWWIHRORPL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|