C22H24FN5O2 — CID 144772910
1,3-diamino-1-[2-[[4-(3-fluoro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]-3-methylphenyl]urea (PubChem CID 144772910) has the molecular formula C22H24FN5O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[4-(3-fluoro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[[4-(3-fluoro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 144772910 |
| Molecular Formula | C22H24FN5O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1,3-diamino-1-[2-[[4-(3-fluoro-2-pyridinyl)-2,5-dimethylphenoxy]methyl]-3-methylphenyl]urea |
| SMILES | Cc1cc(-c2ncccc2F)c(C)cc1OCc1c(C)cccc1N(N)C(=O)NN |
| InChI | InChI=1S/C22H24FN5O2/c1-13-6-4-8-19(28(25)22(29)27-24)17(13)12-30-20-11-14(2)16(10-15(20)3)21-18(23)7-5-9-26-21/h4-11H,12,24-25H2,1-3H3,(H,27,29) |
| InChIKey | XZOYPJVIDSTMRC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|