C13H15ClN6O2 — CID 146632197
1,3-diamino-1-[2-[(6-chloropyrazin-2-yl)oxymethyl]-3-methylphenyl]urea (PubChem CID 146632197) has the molecular formula C13H15ClN6O2 and a molecular weight of 322.76 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(6-chloropyrazin-2-yl)oxymethyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[(6-chloropyrazin-2-yl)oxymethyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 146632197 |
| Molecular Formula | C13H15ClN6O2 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1,3-diamino-1-[2-[(6-chloropyrazin-2-yl)oxymethyl]-3-methylphenyl]urea |
| SMILES | Cc1cccc(N(N)C(=O)NN)c1COc1cncc(Cl)n1 |
| InChI | InChI=1S/C13H15ClN6O2/c1-8-3-2-4-10(20(16)13(21)19-15)9(8)7-22-12-6-17-5-11(14)18-12/h2-6H,7,15-16H2,1H3,(H,19,21) |
| InChIKey | JARLIHPBDBNHPL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|