C19H25BrN4O2 — CID 144784940
1,3-diamino-1-[2-[(4-bromo-3-tert-butylphenoxy)methyl]-3-methylphenyl]urea (PubChem CID 144784940) has the molecular formula C19H25BrN4O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(4-bromo-3-tert-butylphenoxy)methyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[(4-bromo-3-tert-butylphenoxy)methyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 144784940 |
| Molecular Formula | C19H25BrN4O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1,3-diamino-1-[2-[(4-bromo-3-tert-butylphenoxy)methyl]-3-methylphenyl]urea |
| SMILES | Cc1cccc(N(N)C(=O)NN)c1COc1ccc(Br)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H25BrN4O2/c1-12-6-5-7-17(24(22)18(25)23-21)14(12)11-26-13-8-9-16(20)15(10-13)19(2,3)4/h5-10H,11,21-22H2,1-4H3,(H,23,25) |
| InChIKey | TXJJHGWTSCLSJV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|