C21H21F2N5O3 — CID 146633047
1,3-diamino-1-[2-[[6-(4,5-difluoro-2-methoxyphenyl)-2-pyridinyl]oxymethyl]-3-methylphenyl]urea (PubChem CID 146633047) has the molecular formula C21H21F2N5O3 and a molecular weight of 429.43 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[6-(4,5-difluoro-2-methoxyphenyl)-2-pyridinyl]oxymethyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[[6-(4,5-difluoro-2-methoxyphenyl)-2-pyridinyl]oxymethyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 146633047 |
| Molecular Formula | C21H21F2N5O3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1,3-diamino-1-[2-[[6-(4,5-difluoro-2-methoxyphenyl)-2-pyridinyl]oxymethyl]-3-methylphenyl]urea |
| SMILES | COc1cc(F)c(F)cc1-c1cccc(OCc2c(C)cccc2N(N)C(=O)NN)n1 |
| InChI | InChI=1S/C21H21F2N5O3/c1-12-5-3-7-18(28(25)21(29)27-24)14(12)11-31-20-8-4-6-17(26-20)13-9-15(22)16(23)10-19(13)30-2/h3-10H,11,24-25H2,1-2H3,(H,27,29) |
| InChIKey | ZBHKTOZXHZYDOM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|