C22H24N4O3 — CID 146633001
1,3-diamino-1-[2-[[3-(3-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]urea (PubChem CID 146633001) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[3-(3-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[[3-(3-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 146633001 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1,3-diamino-1-[2-[[3-(3-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]urea |
| SMILES | COc1cccc(-c2cccc(OCc3c(C)cccc3N(N)C(=O)NN)c2)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-15-6-3-11-21(26(24)22(27)25-23)20(15)14-29-19-10-5-8-17(13-19)16-7-4-9-18(12-16)28-2/h3-13H,14,23-24H2,1-2H3,(H,25,27) |
| InChIKey | JICKPGSCVNWCBI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|