C22H31BN4O4 — CID 144785152
1,3-diamino-1-[3-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]urea (PubChem CID 144785152) has the molecular formula C22H31BN4O4 and a molecular weight of 426.33 g/mol. Its IUPAC name is 1,3-diamino-1-[3-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]urea.
| Compound Name | 1,3-diamino-1-[3-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]urea |
|---|---|
| PubChem CID | 144785152 |
| Molecular Formula | C22H31BN4O4 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1,3-diamino-1-[3-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]phenyl]urea |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1OCc1c(C)cccc1N(N)C(=O)NN |
| InChI | InChI=1S/C22H31BN4O4/c1-14-8-7-9-18(27(25)20(28)26-24)17(14)13-29-19-11-10-16(12-15(19)2)23-30-21(3,4)22(5,6)31-23/h7-12H,13,24-25H2,1-6H3,(H,26,28) |
| InChIKey | OVBRQFZBRNWAER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|