C18H23BrN4O2 — CID 139453824
1,3-diamino-1-[2-[(4-bromo-2,5-dimethylphenoxy)methyl]-3-methylphenyl]-3-methylurea (PubChem CID 139453824) has the molecular formula C18H23BrN4O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(4-bromo-2,5-dimethylphenoxy)methyl]-3-methylphenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[(4-bromo-2,5-dimethylphenoxy)methyl]-3-methylphenyl]-3-methylurea |
|---|---|
| PubChem CID | 139453824 |
| Molecular Formula | C18H23BrN4O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1,3-diamino-1-[2-[(4-bromo-2,5-dimethylphenoxy)methyl]-3-methylphenyl]-3-methylurea |
| SMILES | Cc1cc(OCc2c(C)cccc2N(N)C(=O)N(C)N)c(C)cc1Br |
| InChI | InChI=1S/C18H23BrN4O2/c1-11-6-5-7-16(23(21)18(24)22(4)20)14(11)10-25-17-9-12(2)15(19)8-13(17)3/h5-9H,10,20-21H2,1-4H3 |
| InChIKey | XTBPIBJMLUEXNH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|