C22H27BrN6O3 — CID 129109978
1,3-diamino-1-[2-[[4-(4-bromo-5-methoxy-1-methylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-3-methylurea (PubChem CID 129109978) has the molecular formula C22H27BrN6O3 and a molecular weight of 503.40 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[4-(4-bromo-5-methoxy-1-methylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[[4-(4-bromo-5-methoxy-1-methylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-3-methylurea |
|---|---|
| PubChem CID | 129109978 |
| Molecular Formula | C22H27BrN6O3 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 1,3-diamino-1-[2-[[4-(4-bromo-5-methoxy-1-methylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-3-methylurea |
| SMILES | COc1c(Br)c(-c2ccc(OCc3c(C)cccc3N(N)C(=O)N(C)N)c(C)c2)nn1C |
| InChI | InChI=1S/C22H27BrN6O3/c1-13-7-6-8-17(29(25)22(30)27(3)24)16(13)12-32-18-10-9-15(11-14(18)2)20-19(23)21(31-5)28(4)26-20/h6-11H,12,24-25H2,1-5H3 |
| InChIKey | RDWSMQLGEMLBAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|