C22H27ClN6O — CID 144820633
1-[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-1-(1-hydrazinylethenyl)hydrazine (PubChem CID 144820633) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is 1-[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-1-(1-hydrazinylethenyl)hydrazine.
| Compound Name | 1-[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-1-(1-hydrazinylethenyl)hydrazine |
|---|---|
| PubChem CID | 144820633 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-3-methylphenyl]-1-(1-hydrazinylethenyl)hydrazine |
| SMILES | C=C(NN)N(N)c1cccc(C)c1COc1ccc(-c2nn(C)c(Cl)c2C)cc1C |
| InChI | InChI=1S/C22H27ClN6O/c1-13-7-6-8-19(29(25)16(4)26-24)18(13)12-30-20-10-9-17(11-14(20)2)21-15(3)22(23)28(5)27-21/h6-11,26H,4,12,24-25H2,1-3,5H3 |
| InChIKey | NXGDUVPSTZXSKP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|