About [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate
[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate (PubChem CID 91809238) has the molecular formula C22H24ClN3O3
and a molecular weight of 413.91 g/mol. Its IUPAC name is [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate |
| PubChem CID | 91809238 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1c(C)cccc1COc1ccc(-c2nn(C)c(Cl)c2C)cc1C |
| InChI | InChI=1S/C22H24ClN3O3/c1-13-7-6-8-17(20(13)29-22(27)24-4)12-28-18-10-9-16(11-14(18)2)19-15(3)21(23)26(5)25-19/h6-11H,12H2,1-5H3,(H,24,27) |
| InChIKey | SACWOTXKDKNZTP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate?
The IUPAC name of [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate (CID 91809238) is [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate.
What is the SMILES notation for [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate?
The canonical SMILES for [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate is CNC(=O)Oc1c(C)cccc1COc1ccc(-c2nn(C)c(Cl)c2C)cc1C.
What is the InChIKey of [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate?
The InChIKey is SACWOTXKDKNZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN3O3/c1-13-7-6-8-17(20(13)29-22(27)24-4)12-28-18-10-9-16(11-14(18)2)19-15(3)21(23)26(5)25-19/h6-11H,12H2,1-5H3,(H,24,27).
What are the key properties of [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate?
[2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate has a molecular weight of 413.91 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[4-(5-chloro-1,4-dimethylpyrazol-3-yl)-2-methylphenoxy]methyl]-6-methylphenyl] N-methylcarbamate is sourced from PubChem (CID 91809238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).