C21H22ClN3O3 — CID 129040541
5-chloro-3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-1,4-dimethylpyrazole (PubChem CID 129040541) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 5-chloro-3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-1,4-dimethylpyrazole.
| Compound Name | 5-chloro-3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-1,4-dimethylpyrazole |
|---|---|
| PubChem CID | 129040541 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-chloro-3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-1,4-dimethylpyrazole |
| SMILES | CCc1cccc(COc2ccc(-c3nn(C)c(Cl)c3C)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22ClN3O3/c1-5-15-7-6-8-17(20(15)25(26)27)12-28-18-10-9-16(11-13(18)2)19-14(3)21(22)24(4)23-19/h6-11H,5,12H2,1-4H3 |
| InChIKey | TTZHEUVFVOCKAA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|