C21H22IN3O3 — CID 126515870
3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-5-(iodomethyl)-4-methyl-1H-pyrazole (PubChem CID 126515870) has the molecular formula C21H22IN3O3 and a molecular weight of 491.33 g/mol. Its IUPAC name is 3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-5-(iodomethyl)-4-methyl-1H-pyrazole.
| Compound Name | 3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-5-(iodomethyl)-4-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 126515870 |
| Molecular Formula | C21H22IN3O3 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 3-[4-[(3-ethyl-2-nitrophenyl)methoxy]-3-methylphenyl]-5-(iodomethyl)-4-methyl-1H-pyrazole |
| SMILES | CCc1cccc(COc2ccc(-c3n[nH]c(CI)c3C)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22IN3O3/c1-4-15-6-5-7-17(21(15)25(26)27)12-28-19-9-8-16(10-13(19)2)20-14(3)18(11-22)23-24-20/h5-10H,4,11-12H2,1-3H3,(H,23,24) |
| InChIKey | YBOJIWNJQWJXBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|