C15H17BrN4O3 — CID 144659368
1,3-diamino-1-[2-[(2-bromo-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea (PubChem CID 144659368) has the molecular formula C15H17BrN4O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(2-bromo-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[(2-bromo-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 144659368 |
| Molecular Formula | C15H17BrN4O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 1,3-diamino-1-[2-[(2-bromo-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea |
| SMILES | CN(N)C(=O)N(N)c1ccccc1COc1ccc(O)cc1Br |
| InChI | InChI=1S/C15H17BrN4O3/c1-19(17)15(22)20(18)13-5-3-2-4-10(13)9-23-14-7-6-11(21)8-12(14)16/h2-8,21H,9,17-18H2,1H3 |
| InChIKey | PEYFBCCSJHXDEZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|