C18H22F2N4O3 — CID 144659566
1,3-diamino-1-[3-(difluoromethyl)-2-[(2-ethyl-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea (PubChem CID 144659566) has the molecular formula C18H22F2N4O3 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1,3-diamino-1-[3-(difluoromethyl)-2-[(2-ethyl-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[3-(difluoromethyl)-2-[(2-ethyl-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 144659566 |
| Molecular Formula | C18H22F2N4O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1,3-diamino-1-[3-(difluoromethyl)-2-[(2-ethyl-4-hydroxyphenoxy)methyl]phenyl]-3-methylurea |
| SMILES | CCc1cc(O)ccc1OCc1c(C(F)F)cccc1N(N)C(=O)N(C)N |
| InChI | InChI=1S/C18H22F2N4O3/c1-3-11-9-12(25)7-8-16(11)27-10-14-13(17(19)20)5-4-6-15(14)24(22)18(26)23(2)21/h4-9,17,25H,3,10,21-22H2,1-2H3 |
| InChIKey | PBVQZZSCDAZNGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|