C18H22Cl2N4O3 — CID 129110347
1,3-diamino-1-[2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-ethoxyphenyl]-3-methylurea (PubChem CID 129110347) has the molecular formula C18H22Cl2N4O3 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-ethoxyphenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-ethoxyphenyl]-3-methylurea |
|---|---|
| PubChem CID | 129110347 |
| Molecular Formula | C18H22Cl2N4O3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1,3-diamino-1-[2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-ethoxyphenyl]-3-methylurea |
| SMILES | CCOc1cccc(N(N)C(=O)N(C)N)c1COc1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N4O3/c1-4-26-16-7-5-6-15(24(22)18(25)23(3)21)12(16)10-27-17-9-13(19)11(2)8-14(17)20/h5-9H,4,10,21-22H2,1-3H3 |
| InChIKey | RLBGNAIRNCGYMX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|