C9H13BrN4O — CID 134360567
1,3-diamino-1-[2-(bromomethyl)phenyl]-3-methylurea (PubChem CID 134360567) has the molecular formula C9H13BrN4O and a molecular weight of 273.13 g/mol. Its IUPAC name is 1,3-diamino-1-[2-(bromomethyl)phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-(bromomethyl)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 134360567 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 1,3-diamino-1-[2-(bromomethyl)phenyl]-3-methylurea |
| SMILES | CN(N)C(=O)N(N)c1ccccc1CBr |
| InChI | InChI=1S/C9H13BrN4O/c1-13(11)9(15)14(12)8-5-3-2-4-7(8)6-10/h2-5H,6,11-12H2,1H3 |
| InChIKey | BACKPZQVFHOGON-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|