C12H22N4O — CID 144597779
1,3-diamino-1-(2,3-dimethylphenyl)-3-methylurea;ethane (PubChem CID 144597779) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,3-diamino-1-(2,3-dimethylphenyl)-3-methylurea;ethane.
| Compound Name | 1,3-diamino-1-(2,3-dimethylphenyl)-3-methylurea;ethane |
|---|---|
| PubChem CID | 144597779 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1,3-diamino-1-(2,3-dimethylphenyl)-3-methylurea;ethane |
| SMILES | CC.Cc1cccc(N(N)C(=O)N(C)N)c1C |
| InChI | InChI=1S/C10H16N4O.C2H6/c1-7-5-4-6-9(8(7)2)14(12)10(15)13(3)11;1-2/h4-6H,11-12H2,1-3H3;1-2H3 |
| InChIKey | LNCQNPADRAMIRE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|