C9H15NSi — CID 137327271
N,2,3-trimethyl-N-silylaniline (PubChem CID 137327271) has the molecular formula C9H15NSi and a molecular weight of 165.31 g/mol. Its IUPAC name is N,2,3-trimethyl-N-silylaniline.
| Compound Name | N,2,3-trimethyl-N-silylaniline |
|---|---|
| PubChem CID | 137327271 |
| Molecular Formula | C9H15NSi |
| Molecular Weight | 165.31 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N,2,3-trimethyl-N-silylaniline |
| SMILES | Cc1cccc(N(C)[SiH3])c1C |
| InChI | InChI=1S/C9H15NSi/c1-7-5-4-6-9(8(7)2)10(3)11/h4-6H,1-3,11H3 |
| InChIKey | IRWCJGMMJXFFHB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|