C14H15NO — CID 141495337
N-(2,3-dimethylphenyl)-N-phenylhydroxylamine (PubChem CID 141495337) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N-phenylhydroxylamine.
| Compound Name | N-(2,3-dimethylphenyl)-N-phenylhydroxylamine |
|---|---|
| PubChem CID | 141495337 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N-phenylhydroxylamine |
| SMILES | Cc1cccc(N(O)c2ccccc2)c1C |
| InChI | InChI=1S/C14H15NO/c1-11-7-6-10-14(12(11)2)15(16)13-8-4-3-5-9-13/h3-10,16H,1-2H3 |
| InChIKey | SFBMOVVCNRWSCK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|