C11H13NO3 — CID 4091384
2-(N-formyl-2,3-dimethylanilino)acetic acid (PubChem CID 4091384) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(N-formyl-2,3-dimethylanilino)acetic acid.
| Compound Name | 2-(N-formyl-2,3-dimethylanilino)acetic acid |
|---|---|
| PubChem CID | 4091384 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(N-formyl-2,3-dimethylanilino)acetic acid |
| SMILES | Cc1cccc(N(C=O)CC(=O)O)c1C |
| InChI | InChI=1S/C11H13NO3/c1-8-4-3-5-10(9(8)2)12(7-13)6-11(14)15/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | VJNFGUWSQPMMIW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|