2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid

C11H15NO4S — CID 975035

IUPAC2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid
SMILESCc1cccc(N(CC(=O)O)S(C)(=O)=O)c1C
InChIInChI=1S/C11H15NO4S/c1-8-5-4-6-10(9(8)2)12(7-11(13)14)17(3,15)16/h4-6H,7H2,1-3H3,(H,13,14)
InChIKeyXDGKCDLOAWRWJU-UHFFFAOYSA-N
MW257.31 g/mol
LogP1.15
Rot. Bonds4

About 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid

2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid (PubChem CID 975035) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid.

Molecular Properties

Compound Name2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid
PubChem CID975035
Molecular FormulaC11H15NO4S
Molecular Weight257.31 g/mol
Exact Mass257.07
IUPAC Name2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid
SMILESCc1cccc(N(CC(=O)O)S(C)(=O)=O)c1C
InChIInChI=1S/C11H15NO4S/c1-8-5-4-6-10(9(8)2)12(7-11(13)14)17(3,15)16/h4-6H,7H2,1-3H3,(H,13,14)
InChIKeyXDGKCDLOAWRWJU-UHFFFAOYSA-N
XLogP1.15
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.31
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid?
The IUPAC name of 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid (CID 975035) is 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid.
What is the SMILES notation for 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid?
The canonical SMILES for 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid is Cc1cccc(N(CC(=O)O)S(C)(=O)=O)c1C.
What is the InChIKey of 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid?
The InChIKey is XDGKCDLOAWRWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S/c1-8-5-4-6-10(9(8)2)12(7-11(13)14)17(3,15)16/h4-6H,7H2,1-3H3,(H,13,14).
What are the key properties of 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid?
2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid has a molecular weight of 257.31 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-N-methylsulfonylanilino)acetic acid is sourced from PubChem (CID 975035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).