C12H19NO2 — CID 67257224
1-[N-(1-hydroxyethyl)-2,3-dimethylanilino]ethanol (PubChem CID 67257224) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[N-(1-hydroxyethyl)-2,3-dimethylanilino]ethanol.
| Compound Name | 1-[N-(1-hydroxyethyl)-2,3-dimethylanilino]ethanol |
|---|---|
| PubChem CID | 67257224 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-[N-(1-hydroxyethyl)-2,3-dimethylanilino]ethanol |
| SMILES | Cc1cccc(N(C(C)O)C(C)O)c1C |
| InChI | InChI=1S/C12H19NO2/c1-8-6-5-7-12(9(8)2)13(10(3)14)11(4)15/h5-7,10-11,14-15H,1-4H3 |
| InChIKey | VGWVULYMCZVXRC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|