About (2R)-1-(N,2,3-trimethylanilino)butan-2-ol
(2R)-1-(N,2,3-trimethylanilino)butan-2-ol (PubChem CID 111487530) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is (2R)-1-(N,2,3-trimethylanilino)butan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-(N,2,3-trimethylanilino)butan-2-ol |
| PubChem CID | 111487530 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2R)-1-(N,2,3-trimethylanilino)butan-2-ol |
| SMILES | CC[C@@H](O)CN(C)c1cccc(C)c1C |
| InChI | InChI=1S/C13H21NO/c1-5-12(15)9-14(4)13-8-6-7-10(2)11(13)3/h6-8,12,15H,5,9H2,1-4H3/t12-/m1/s1 |
| InChIKey | KYEFERZTECNQKK-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-(N,2,3-trimethylanilino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(N,2,3-trimethylanilino)butan-2-ol?
The IUPAC name of (2R)-1-(N,2,3-trimethylanilino)butan-2-ol (CID 111487530) is (2R)-1-(N,2,3-trimethylanilino)butan-2-ol.
What is the SMILES notation for (2R)-1-(N,2,3-trimethylanilino)butan-2-ol?
The canonical SMILES for (2R)-1-(N,2,3-trimethylanilino)butan-2-ol is CC[C@@H](O)CN(C)c1cccc(C)c1C.
What is the InChIKey of (2R)-1-(N,2,3-trimethylanilino)butan-2-ol?
The InChIKey is KYEFERZTECNQKK-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H21NO/c1-5-12(15)9-14(4)13-8-6-7-10(2)11(13)3/h6-8,12,15H,5,9H2,1-4H3/t12-/m1/s1.
What are the key properties of (2R)-1-(N,2,3-trimethylanilino)butan-2-ol?
(2R)-1-(N,2,3-trimethylanilino)butan-2-ol has a molecular weight of 207.32 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(N,2,3-trimethylanilino)butan-2-ol is sourced from PubChem (CID 111487530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).