C11H14BrNO — CID 10682477
2-bromo-N-(2,3-dimethylphenyl)-N-methylacetamide (PubChem CID 10682477) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dimethylphenyl)-N-methylacetamide.
| Compound Name | 2-bromo-N-(2,3-dimethylphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 10682477 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-bromo-N-(2,3-dimethylphenyl)-N-methylacetamide |
| SMILES | Cc1cccc(N(C)C(=O)CBr)c1C |
| InChI | InChI=1S/C11H14BrNO/c1-8-5-4-6-10(9(8)2)13(3)11(14)7-12/h4-6H,7H2,1-3H3 |
| InChIKey | HHKZVJXDJUBJPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|