C19H23NO2 — CID 86938178
N-(2,3-dimethylphenyl)-4-ethoxy-N,3-dimethylbenzamide (PubChem CID 86938178) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-ethoxy-N,3-dimethylbenzamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-ethoxy-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 86938178 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-ethoxy-N,3-dimethylbenzamide |
| SMILES | CCOc1ccc(C(=O)N(C)c2cccc(C)c2C)cc1C |
| InChI | InChI=1S/C19H23NO2/c1-6-22-18-11-10-16(12-14(18)3)19(21)20(5)17-9-7-8-13(2)15(17)4/h7-12H,6H2,1-5H3 |
| InChIKey | NPBMTVULEBLCRJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |