C20H21NO3 — CID 86938319
4-ethoxy-N,3-dimethyl-N-(4-prop-2-ynoxyphenyl)benzamide (PubChem CID 86938319) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-ethoxy-N,3-dimethyl-N-(4-prop-2-ynoxyphenyl)benzamide.
| Compound Name | 4-ethoxy-N,3-dimethyl-N-(4-prop-2-ynoxyphenyl)benzamide |
|---|---|
| PubChem CID | 86938319 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-ethoxy-N,3-dimethyl-N-(4-prop-2-ynoxyphenyl)benzamide |
| SMILES | C#CCOc1ccc(N(C)C(=O)c2ccc(OCC)c(C)c2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-5-13-24-18-10-8-17(9-11-18)21(4)20(22)16-7-12-19(23-6-2)15(3)14-16/h1,7-12,14H,6,13H2,2-4H3 |
| InChIKey | FXSDWVYPDJWPBQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|