C17H14F5NO — CID 166187270
N-(2,3-dimethylphenyl)-N-methyl-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 166187270) has the molecular formula C17H14F5NO and a molecular weight of 343.30 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N-methyl-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-N-methyl-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 166187270 |
| Molecular Formula | C17H14F5NO |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N-methyl-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1cccc(N(C)C(=O)Cc2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C17H14F5NO/c1-8-5-4-6-11(9(8)2)23(3)12(24)7-10-13(18)15(20)17(22)16(21)14(10)19/h4-6H,7H2,1-3H3 |
| InChIKey | NXVWVUGAGLDUTA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|