C11H17IN4O2 — CID 155217818
1,3-diamino-1-(2-iodo-3-propan-2-yloxyphenyl)-3-methylurea (PubChem CID 155217818) has the molecular formula C11H17IN4O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 1,3-diamino-1-(2-iodo-3-propan-2-yloxyphenyl)-3-methylurea.
| Compound Name | 1,3-diamino-1-(2-iodo-3-propan-2-yloxyphenyl)-3-methylurea |
|---|---|
| PubChem CID | 155217818 |
| Molecular Formula | C11H17IN4O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1,3-diamino-1-(2-iodo-3-propan-2-yloxyphenyl)-3-methylurea |
| SMILES | CC(C)Oc1cccc(N(N)C(=O)N(C)N)c1I |
| InChI | InChI=1S/C11H17IN4O2/c1-7(2)18-9-6-4-5-8(10(9)12)16(14)11(17)15(3)13/h4-7H,13-14H2,1-3H3 |
| InChIKey | CAGUPMWPLXWOHA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|